C39H60O6SSi2 — CID 11170030
2-[(2R,4R)-4-[[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methyl]-3-oxothiolan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 11170030) has the molecular formula C39H60O6SSi2 and a molecular weight of 713.14 g/mol. Its IUPAC name is 2-[(2R,4R)-4-[[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methyl]-3-oxothiolan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2R,4R)-4-[[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methyl]-3-oxothiolan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11170030 |
| Molecular Formula | C39H60O6SSi2 |
| Molecular Weight | 713.14 g/mol |
| Exact Mass | 712.36 |
| IUPAC Name | 2-[(2R,4R)-4-[[(2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]methyl]-3-oxothiolan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC[C@H]1SC[C@H](C[C@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]2O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C39H60O6SSi2/c1-37(2,3)36(41)42-23-22-34-35(40)28(27-46-34)24-32-33(45-47(10,11)38(4,5)6)25-29(44-32)26-43-48(39(7,8)9,30-18-14-12-15-19-30)31-20-16-13-17-21-31/h12-21,28-29,32-34H,22-27H2,1-11H3/t28-,29-,32+,33+,34+/m0/s1 |
| InChIKey | JGCKEBDGLIKPBQ-QNYYBNBXSA-N |
| XLogP | 7.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.14 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|