C30H46O4Si2 — CID 71523785
(3R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxolan-2-one (PubChem CID 71523785) has the molecular formula C30H46O4Si2 and a molecular weight of 526.87 g/mol. Its IUPAC name is (3R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxolan-2-one.
| Compound Name | (3R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 71523785 |
| Molecular Formula | C30H46O4Si2 |
| Molecular Weight | 526.87 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | (3R,5S)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxy-3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@@H]([C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[Si](C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C30H46O4Si2/c1-23-22-27(33-28(23)31)26(34-35(8,9)29(2,3)4)20-21-32-36(30(5,6)7,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,23,26-27H,20-22H2,1-9H3/t23-,26+,27+/m1/s1 |
| InChIKey | HUTRRDFLWHBWKM-NPAAKHOSSA-N |
| XLogP | 6.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.87 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|