C38H56O4Si2 — CID 11520160
but-3-en-2-yl 2-[(1R,2S,5R,6R)-6-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxycyclohex-3-en-1-yl]acetate (PubChem CID 11520160) has the molecular formula C38H56O4Si2 and a molecular weight of 633.03 g/mol. Its IUPAC name is but-3-en-2-yl 2-[(1R,2S,5R,6R)-6-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxycyclohex-3-en-1-yl]acetate.
| Compound Name | but-3-en-2-yl 2-[(1R,2S,5R,6R)-6-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxycyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 11520160 |
| Molecular Formula | C38H56O4Si2 |
| Molecular Weight | 633.03 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | but-3-en-2-yl 2-[(1R,2S,5R,6R)-6-but-3-enyl-5-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxycyclohex-3-en-1-yl]acetate |
| SMILES | C=CCC[C@@H]1[C@@H](CC(=O)OC(C)C=C)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H56O4Si2/c1-12-14-25-32-33(28-36(39)40-29(3)13-2)35(27-26-34(32)41-43(10,11)37(4,5)6)42-44(38(7,8)9,30-21-17-15-18-22-30)31-23-19-16-20-24-31/h12-13,15-24,26-27,29,32-35H,1-2,14,25,28H2,3-11H3/t29?,32-,33-,34-,35+/m1/s1 |
| InChIKey | HMAQUHKGSFXMDY-HUEPEVCMSA-N |
| XLogP | 8.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.03 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|