C36H52O4Si2 — CID 11714178
(4R,5Z,8aR,9R,12S,12aR)-9-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-4-methyl-1,4,7,8,8a,9,12,12a-octahydro-3-benzoxecin-2-one (PubChem CID 11714178) has the molecular formula C36H52O4Si2 and a molecular weight of 604.98 g/mol. Its IUPAC name is (4R,5Z,8aR,9R,12S,12aR)-9-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-4-methyl-1,4,7,8,8a,9,12,12a-octahydro-3-benzoxecin-2-one.
| Compound Name | (4R,5Z,8aR,9R,12S,12aR)-9-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-4-methyl-1,4,7,8,8a,9,12,12a-octahydro-3-benzoxecin-2-one |
|---|---|
| PubChem CID | 11714178 |
| Molecular Formula | C36H52O4Si2 |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | (4R,5Z,8aR,9R,12S,12aR)-9-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-4-methyl-1,4,7,8,8a,9,12,12a-octahydro-3-benzoxecin-2-one |
| SMILES | C[C@@H]1/C=C\CC[C@@H]2[C@@H](CC(=O)O1)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H52O4Si2/c1-27-18-16-17-23-30-31(26-34(37)38-27)33(25-24-32(30)39-41(8,9)35(2,3)4)40-42(36(5,6)7,28-19-12-10-13-20-28)29-21-14-11-15-22-29/h10-16,18-22,24-25,27,30-33H,17,23,26H2,1-9H3/b18-16-/t27-,30-,31-,32-,33+/m1/s1 |
| InChIKey | HXAFCHFRRNLKCB-OFIWWVKOSA-N |
| XLogP | 7.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|