C29H38O8Si2 — CID 10745648
methyl (5R,8R,9S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dioxo-9-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonane-9-carboxylate (PubChem CID 10745648) has the molecular formula C29H38O8Si2 and a molecular weight of 570.79 g/mol. Its IUPAC name is methyl (5R,8R,9S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dioxo-9-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonane-9-carboxylate.
| Compound Name | methyl (5R,8R,9S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dioxo-9-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonane-9-carboxylate |
|---|---|
| PubChem CID | 10745648 |
| Molecular Formula | C29H38O8Si2 |
| Molecular Weight | 570.79 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | methyl (5R,8R,9S)-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,6-dioxo-9-trimethylsilyloxy-1,7-dioxaspiro[4.4]nonane-9-carboxylate |
| SMILES | COC(=O)[C@]1(O[Si](C)(C)C)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)[C@@]12CCC(=O)O2 |
| InChI | InChI=1S/C29H38O8Si2/c1-27(2,3)39(21-14-10-8-11-15-21,22-16-12-9-13-17-22)34-20-23-29(26(32)33-4,37-38(5,6)7)28(25(31)35-23)19-18-24(30)36-28/h8-17,23H,18-20H2,1-7H3/t23-,28+,29-/m1/s1 |
| InChIKey | PFDKQHBRJILUNT-LDVROUIZSA-N |
| XLogP | 3.33 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|