C31H40O7Si — CID 146168472
methyl (1S,2R,5S,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyacetyl]oxy-1-methyl-3-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 146168472) has the molecular formula C31H40O7Si and a molecular weight of 552.74 g/mol. Its IUPAC name is methyl (1S,2R,5S,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyacetyl]oxy-1-methyl-3-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1S,2R,5S,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyacetyl]oxy-1-methyl-3-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 146168472 |
| Molecular Formula | C31H40O7Si |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | methyl (1S,2R,5S,7R)-7-[2-[tert-butyl(diphenyl)silyl]oxyacetyl]oxy-1-methyl-3-oxo-5-propan-2-yl-8-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C[C@]2(C(C)C)C[C@@H](OC(=O)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@]1(C)O2 |
| InChI | InChI=1S/C31H40O7Si/c1-21(2)31-18-24(32)27(28(34)35-7)30(6,38-31)25(19-31)37-26(33)20-36-39(29(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,25,27H,18-20H2,1-7H3/t25-,27-,30-,31-/m1/s1 |
| InChIKey | NPACURBNLAXZBN-RSQMPJMXSA-N |
| XLogP | 3.81 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|