C26H36O5Si — CID 10961482
methyl 2-[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(1R)-1-methoxyethyl]oxolan-2-yl]acetate (PubChem CID 10961482) has the molecular formula C26H36O5Si and a molecular weight of 456.66 g/mol. Its IUPAC name is methyl 2-[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(1R)-1-methoxyethyl]oxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(1R)-1-methoxyethyl]oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10961482 |
| Molecular Formula | C26H36O5Si |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | methyl 2-[(2R,3S,5S)-3-[tert-butyl(diphenyl)silyl]oxy-5-[(1R)-1-methoxyethyl]oxolan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@H]([C@@H](C)OC)C[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O5Si/c1-19(28-5)22-17-24(23(30-22)18-25(27)29-6)31-32(26(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19,22-24H,17-18H2,1-6H3/t19-,22+,23-,24+/m1/s1 |
| InChIKey | SDTVHPDFOKMBGO-GOUWZUTHSA-N |
| XLogP | 3.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|