C32H50O4Si2 — CID 11843603
(3R,4S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxepan-2-one (PubChem CID 11843603) has the molecular formula C32H50O4Si2 and a molecular weight of 554.92 g/mol. Its IUPAC name is (3R,4S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxepan-2-one.
| Compound Name | (3R,4S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxepan-2-one |
|---|---|
| PubChem CID | 11843603 |
| Molecular Formula | C32H50O4Si2 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | (3R,4S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropyl]-3-methyloxepan-2-one |
| SMILES | C[C@@H](C[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H50O4Si2/c1-24(23-26-21-22-29(25(2)30(33)34-26)36-37(9,10)31(3,4)5)35-38(32(6,7)8,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-20,24-26,29H,21-23H2,1-10H3/t24-,25+,26-,29-/m0/s1 |
| InChIKey | ZWJJVPUUHGDAJE-BVXNIFABSA-N |
| XLogP | 7.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|