C36H58O4SSi — CID 71659027
S-decyl (3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-methoxy-6,6-dimethylheptanethioate (PubChem CID 71659027) has the molecular formula C36H58O4SSi and a molecular weight of 615.01 g/mol. Its IUPAC name is S-decyl (3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-methoxy-6,6-dimethylheptanethioate.
| Compound Name | S-decyl (3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-methoxy-6,6-dimethylheptanethioate |
|---|---|
| PubChem CID | 71659027 |
| Molecular Formula | C36H58O4SSi |
| Molecular Weight | 615.01 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | S-decyl (3S,5S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-3-methoxy-6,6-dimethylheptanethioate |
| SMILES | CCCCCCCCCCSC(=O)C[C@H](C[C@H](O)C(C)(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC |
| InChI | InChI=1S/C36H58O4SSi/c1-8-9-10-11-12-13-14-21-26-41-34(38)28-30(39-7)27-33(37)36(5,6)29-40-42(35(2,3)4,31-22-17-15-18-23-31)32-24-19-16-20-25-32/h15-20,22-25,30,33,37H,8-14,21,26-29H2,1-7H3/t30-,33-/m0/s1 |
| InChIKey | RROQSNIEUDLZLE-DITALETJSA-N |
| XLogP | 8.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.01 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|