C25H34O4SSi — CID 162418667
S-ethyl 2-[5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]dioxolan-3-yl]ethanethioate (PubChem CID 162418667) has the molecular formula C25H34O4SSi and a molecular weight of 458.70 g/mol. Its IUPAC name is S-ethyl 2-[5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]dioxolan-3-yl]ethanethioate.
| Compound Name | S-ethyl 2-[5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]dioxolan-3-yl]ethanethioate |
|---|---|
| PubChem CID | 162418667 |
| Molecular Formula | C25H34O4SSi |
| Molecular Weight | 458.70 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | S-ethyl 2-[5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]dioxolan-3-yl]ethanethioate |
| SMILES | CCSC(=O)CC1CC(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OO1 |
| InChI | InChI=1S/C25H34O4SSi/c1-5-30-24(26)19-21-18-20(28-29-21)16-17-27-31(25(2,3)4,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,20-21H,5,16-19H2,1-4H3 |
| InChIKey | JJZMGYMQVBSKTJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.70 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|