C27H36O4SSi — CID 101771410
S-ethyl 2-[(2R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate (PubChem CID 101771410) has the molecular formula C27H36O4SSi and a molecular weight of 484.70 g/mol. Its IUPAC name is S-ethyl 2-[(2R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate.
| Compound Name | S-ethyl 2-[(2R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate |
|---|---|
| PubChem CID | 101771410 |
| Molecular Formula | C27H36O4SSi |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | S-ethyl 2-[(2R,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-oxooxan-2-yl]ethanethioate |
| SMILES | CCSC(=O)C[C@H]1CC(=O)C[C@@H](O1)CCO[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C(C)(C)C |
| InChI | InChI=1S/C27H36O4SSi/c1-5-32-26(29)20-23-19-21(28)18-22(31-23)16-17-30-33(27(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,22-23H,5,16-20H2,1-4H3/t22-,23+/m0/s1 |
| InChIKey | ZLYQTONASBLXCK-XZOQPEGZSA-N |
| XLogP | — |
| TPSA | 77.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | 617 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|