C37H54O6S2Si — CID 11104413
(6R)-4-[[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]methyl]-4-hydroxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one (PubChem CID 11104413) has the molecular formula C37H54O6S2Si and a molecular weight of 687.05 g/mol. Its IUPAC name is (6R)-4-[[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]methyl]-4-hydroxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one.
| Compound Name | (6R)-4-[[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]methyl]-4-hydroxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one |
|---|---|
| PubChem CID | 11104413 |
| Molecular Formula | C37H54O6S2Si |
| Molecular Weight | 687.05 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | (6R)-4-[[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]methyl]-4-hydroxy-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-one |
| SMILES | C[C@H]1OC(C)(C)O[C@@H]1C[C@@H]1CC(O)(CC2(C(C)(C)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)SCCCS2)CC(=O)O1 |
| InChI | InChI=1S/C37H54O6S2Si/c1-27-31(43-35(7,8)42-27)22-28-23-36(39,24-32(38)41-28)25-37(44-20-15-21-45-37)34(5,6)26-40-46(33(2,3)4,29-16-11-9-12-17-29)30-18-13-10-14-19-30/h9-14,16-19,27-28,31,39H,15,20-26H2,1-8H3/t27-,28-,31-,36?/m1/s1 |
| InChIKey | LTBVAUAXOTYWPN-HPQOWFCASA-N |
| XLogP | 6.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.05 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|