C34H48O5S3Si — CID 11585534
(2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4a-methyl-4'-[tris(methylsulfanyl)methyl]spiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one (PubChem CID 11585534) has the molecular formula C34H48O5S3Si and a molecular weight of 661.04 g/mol. Its IUPAC name is (2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4a-methyl-4'-[tris(methylsulfanyl)methyl]spiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one.
| Compound Name | (2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4a-methyl-4'-[tris(methylsulfanyl)methyl]spiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 11585534 |
| Molecular Formula | C34H48O5S3Si |
| Molecular Weight | 661.04 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | (2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4a-methyl-4'-[tris(methylsulfanyl)methyl]spiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one |
| SMILES | CSC(SC)(SC)[C@H]1CC(=O)O[C@@]12CC[C@]1(C)O[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@H]1O2 |
| InChI | InChI=1S/C34H48O5S3Si/c1-31(2,3)43(26-14-10-8-11-15-26,27-16-12-9-13-17-27)36-23-20-25-18-19-29-32(4,37-25)21-22-33(38-29)28(24-30(35)39-33)34(40-5,41-6)42-7/h8-17,25,28-29H,18-24H2,1-7H3/t25-,28-,29+,32-,33-/m0/s1 |
| InChIKey | YFUBQHCIEXREAR-LJZFGWQPSA-N |
| XLogP | 7.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.04 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|