C31H42O6Si — CID 11027925
(2S,3aS,7S,7aS)-2-[(4S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one (PubChem CID 11027925) has the molecular formula C31H42O6Si and a molecular weight of 538.76 g/mol. Its IUPAC name is (2S,3aS,7S,7aS)-2-[(4S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one.
| Compound Name | (2S,3aS,7S,7aS)-2-[(4S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one |
|---|---|
| PubChem CID | 11027925 |
| Molecular Formula | C31H42O6Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | (2S,3aS,7S,7aS)-2-[(4S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]-7-methyl-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one |
| SMILES | C[C@H]1CC(=O)O[C@H]2C[C@@H]([C@@H]3C[C@H](CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)OC(C)(C)O3)O[C@H]21 |
| InChI | InChI=1S/C31H42O6Si/c1-21-17-28(32)34-27-19-25(35-29(21)27)26-18-22(36-31(5,6)37-26)20-33-38(30(2,3)4,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,21-22,25-27,29H,17-20H2,1-6H3/t21-,22+,25-,26-,27-,29-/m0/s1 |
| InChIKey | BOVWCLNISMQKKT-DSCOHMENSA-N |
| XLogP | 4.58 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|