C31H44O6Si — CID 102183390
(3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-yl]butanoic acid (PubChem CID 102183390) has the molecular formula C31H44O6Si and a molecular weight of 540.77 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-yl]butanoic acid.
| Compound Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 102183390 |
| Molecular Formula | C31H44O6Si |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (3R)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6R)-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]oxan-2-yl]butanoic acid |
| SMILES | CC1(C)OC[C@@H](C[C@H]2CCC[C@@H](C[C@H](CC(=O)O)O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C31H44O6Si/c1-30(2,3)38(27-15-8-6-9-16-27,28-17-10-7-11-18-28)37-25(21-29(32)33)19-23-13-12-14-24(35-23)20-26-22-34-31(4,5)36-26/h6-11,15-18,23-26H,12-14,19-22H2,1-5H3,(H,32,33)/t23-,24+,25+,26+/m0/s1 |
| InChIKey | RGUSGJDQXFMVJY-BKKFENPESA-N |
| XLogP | 5.28 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|