C33H46O6Si — CID 11512489
[(2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-yl] acetate (PubChem CID 11512489) has the molecular formula C33H46O6Si and a molecular weight of 566.81 g/mol. Its IUPAC name is [(2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-yl] acetate.
| Compound Name | [(2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-yl] acetate |
|---|---|
| PubChem CID | 11512489 |
| Molecular Formula | C33H46O6Si |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | [(2S,4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-yl] acetate |
| SMILES | CC(=O)OC1C[C@H](C)[C@]2(CC[C@]3(C)O[C@H](CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CC[C@H]3O2)O1 |
| InChI | InChI=1S/C33H46O6Si/c1-24-23-30(36-25(2)34)39-33(24)21-20-32(6)29(38-33)18-17-26(37-32)19-22-35-40(31(3,4)5,27-13-9-7-10-14-27)28-15-11-8-12-16-28/h7-16,24,26,29-30H,17-23H2,1-6H3/t24-,26-,29+,30?,32-,33-/m0/s1 |
| InChIKey | KHDSYGHLJKNAPK-GKAHMZEZSA-N |
| XLogP | 5.71 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|