C33H47IO4Si — CID 11456567
tert-butyl-[[(2S,5S,7R,8R)-2-[[(2S,6R)-6-(iodomethyl)oxan-2-yl]methyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]methoxy]-diphenylsilane (PubChem CID 11456567) has the molecular formula C33H47IO4Si and a molecular weight of 662.73 g/mol. Its IUPAC name is tert-butyl-[[(2S,5S,7R,8R)-2-[[(2S,6R)-6-(iodomethyl)oxan-2-yl]methyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,5S,7R,8R)-2-[[(2S,6R)-6-(iodomethyl)oxan-2-yl]methyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11456567 |
| Molecular Formula | C33H47IO4Si |
| Molecular Weight | 662.73 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | tert-butyl-[[(2S,5S,7R,8R)-2-[[(2S,6R)-6-(iodomethyl)oxan-2-yl]methyl]-8-methyl-1,6-dioxaspiro[4.5]decan-7-yl]methoxy]-diphenylsilane |
| SMILES | C[C@@H]1CC[C@@]2(CC[C@@H](C[C@@H]3CCC[C@H](CI)O3)O2)O[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H47IO4Si/c1-25-18-20-33(21-19-27(37-33)22-26-12-11-13-28(23-34)36-26)38-31(25)24-35-39(32(2,3)4,29-14-7-5-8-15-29)30-16-9-6-10-17-30/h5-10,14-17,25-28,31H,11-13,18-24H2,1-4H3/t25-,26+,27+,28-,31+,33+/m1/s1 |
| InChIKey | JZVBYOQCYKDGRU-ZGDHPUFHSA-N |
| XLogP | 7.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.73 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|