C28H40O4Si — CID 46928419
[(2S,3S,6S,8S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]methanol (PubChem CID 46928419) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is [(2S,3S,6S,8S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]methanol.
| Compound Name | [(2S,3S,6S,8S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]methanol |
|---|---|
| PubChem CID | 46928419 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(2S,3S,6S,8S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-1,7-dioxaspiro[5.5]undecan-8-yl]methanol |
| SMILES | C[C@H]1CC[C@]2(CCC[C@@H](CO)O2)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O4Si/c1-22-17-19-28(18-11-12-23(20-29)31-28)32-26(22)21-30-33(27(2,3)4,24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-10,13-16,22-23,26,29H,11-12,17-21H2,1-4H3/t22-,23-,26+,28-/m0/s1 |
| InChIKey | XSVULSGZRPHZHH-TUYNLFGTSA-N |
| XLogP | 4.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|