C34H56O6Si2 — CID 71490040
tert-butyl-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentoxy]-diphenylsilane (PubChem CID 71490040) has the molecular formula C34H56O6Si2 and a molecular weight of 616.99 g/mol. Its IUPAC name is tert-butyl-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 71490040 |
| Molecular Formula | C34H56O6Si2 |
| Molecular Weight | 616.99 g/mol |
| Exact Mass | 616.36 |
| IUPAC Name | tert-butyl-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-methyl-5-(2-methyl-1,3-dioxolan-2-yl)pentoxy]-diphenylsilane |
| SMILES | COCO[C@H]([C@H](C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1(C)OCCO1 |
| InChI | InChI=1S/C34H56O6Si2/c1-27(25-39-42(33(5,6)7,28-18-14-12-15-19-28)29-20-16-13-17-21-29)24-30(40-41(10,11)32(2,3)4)31(36-26-35-9)34(8)37-22-23-38-34/h12-21,27,30-31H,22-26H2,1-11H3/t27-,30+,31-/m1/s1 |
| InChIKey | YSOIYVZUOFHIGE-JMJMSVOMSA-N |
| XLogP | 6.73 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.99 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|