C35H56O5Si2 — CID 11671688
(3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E,3S)-3-(methoxymethoxymethyl)-3-methyl-6-trimethylsilylhex-4-enyl]-3-methyloxolan-2-ol (PubChem CID 11671688) has the molecular formula C35H56O5Si2 and a molecular weight of 613.00 g/mol. Its IUPAC name is (3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E,3S)-3-(methoxymethoxymethyl)-3-methyl-6-trimethylsilylhex-4-enyl]-3-methyloxolan-2-ol.
| Compound Name | (3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E,3S)-3-(methoxymethoxymethyl)-3-methyl-6-trimethylsilylhex-4-enyl]-3-methyloxolan-2-ol |
|---|---|
| PubChem CID | 11671688 |
| Molecular Formula | C35H56O5Si2 |
| Molecular Weight | 613.00 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | (3S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E,3S)-3-(methoxymethoxymethyl)-3-methyl-6-trimethylsilylhex-4-enyl]-3-methyloxolan-2-ol |
| SMILES | COCOC[C@](C)(/C=C/C[Si](C)(C)C)CCC1(O)O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C35H56O5Si2/c1-29-25-30(40-35(29,36)23-22-34(5,27-38-28-37-6)21-16-24-41(7,8)9)26-39-42(33(2,3)4,31-17-12-10-13-18-31)32-19-14-11-15-20-32/h10-21,29-30,36H,22-28H2,1-9H3/b21-16+/t29-,30+,34+,35?/m0/s1 |
| InChIKey | FSGRCLRKWHFHNV-ZZIQPEANSA-N |
| XLogP | 6.98 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.00 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|