C32H44O7Si — CID 53360794
(5R,8R,10R)-10-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8-[(2S)-5-methoxy-2-methyloxolan-2-yl]-1,3,9-trioxaspiro[4.5]decan-2-one (PubChem CID 53360794) has the molecular formula C32H44O7Si and a molecular weight of 568.78 g/mol. Its IUPAC name is (5R,8R,10R)-10-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8-[(2S)-5-methoxy-2-methyloxolan-2-yl]-1,3,9-trioxaspiro[4.5]decan-2-one.
| Compound Name | (5R,8R,10R)-10-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8-[(2S)-5-methoxy-2-methyloxolan-2-yl]-1,3,9-trioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 53360794 |
| Molecular Formula | C32H44O7Si |
| Molecular Weight | 568.78 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | (5R,8R,10R)-10-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-8-[(2S)-5-methoxy-2-methyloxolan-2-yl]-1,3,9-trioxaspiro[4.5]decan-2-one |
| SMILES | COC1CC[C@@](C)([C@H]2CC[C@@]3(COC(=O)O3)[C@@H](CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)O1 |
| InChI | InChI=1S/C32H44O7Si/c1-30(2,3)40(24-13-8-6-9-14-24,25-15-10-7-11-16-25)36-22-12-17-27-32(23-35-29(33)39-32)21-18-26(37-27)31(4)20-19-28(34-5)38-31/h6-11,13-16,26-28H,12,17-23H2,1-5H3/t26-,27-,28?,31+,32-/m1/s1 |
| InChIKey | SOPKVLVHJFSNRE-LPSNSGITSA-N |
| XLogP | 5.34 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.78 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|