C34H50O5Si — CID 139089511
tert-butyl-[(2S)-2-[(4S,5R,6S)-6-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane (PubChem CID 139089511) has the molecular formula C34H50O5Si and a molecular weight of 566.86 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(4S,5R,6S)-6-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(4S,5R,6S)-6-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 139089511 |
| Molecular Formula | C34H50O5Si |
| Molecular Weight | 566.86 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | tert-butyl-[(2S)-2-[(4S,5R,6S)-6-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propoxy]-diphenylsilane |
| SMILES | C[C@@H]1[C@H]([C@@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O[C@@H]1[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C34H50O5Si/c1-25(23-36-40(32(3,4)5,27-17-11-8-12-18-27)28-19-13-9-14-20-28)30-26(2)31(39-33(6,7)38-30)29-24-35-34(37-29)21-15-10-16-22-34/h8-9,11-14,17-20,25-26,29-31H,10,15-16,21-24H2,1-7H3/t25-,26+,29-,30-,31-/m0/s1 |
| InChIKey | HZPOCJYEABGOOM-ZVHCFVJJSA-N |
| XLogP | 6.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.86 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|