C41H52O5Si — CID 11445179
tert-butyl-[(E)-5-[(4S,6R,8R,11S,13S)-13-methyl-11-phenylmethoxy-5,7,9-trioxadispiro[5.1.58.26]pentadec-1-en-4-yl]pent-4-enoxy]-diphenylsilane (PubChem CID 11445179) has the molecular formula C41H52O5Si and a molecular weight of 652.95 g/mol. Its IUPAC name is tert-butyl-[(E)-5-[(4S,6R,8R,11S,13S)-13-methyl-11-phenylmethoxy-5,7,9-trioxadispiro[5.1.58.26]pentadec-1-en-4-yl]pent-4-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-5-[(4S,6R,8R,11S,13S)-13-methyl-11-phenylmethoxy-5,7,9-trioxadispiro[5.1.58.26]pentadec-1-en-4-yl]pent-4-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11445179 |
| Molecular Formula | C41H52O5Si |
| Molecular Weight | 652.95 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | tert-butyl-[(E)-5-[(4S,6R,8R,11S,13S)-13-methyl-11-phenylmethoxy-5,7,9-trioxadispiro[5.1.58.26]pentadec-1-en-4-yl]pent-4-enoxy]-diphenylsilane |
| SMILES | C[C@H]1C[C@H](OCc2ccccc2)CO[C@@]12CC[C@]1(C=CC[C@@H](/C=C/CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O1)O2 |
| InChI | InChI=1S/C41H52O5Si/c1-33-30-36(42-31-34-18-9-5-10-19-34)32-43-41(33)28-27-40(46-41)26-17-21-35(45-40)20-11-8-16-29-44-47(39(2,3)4,37-22-12-6-13-23-37)38-24-14-7-15-25-38/h5-7,9-15,17-20,22-26,33,35-36H,8,16,21,27-32H2,1-4H3/b20-11+/t33-,35+,36-,40-,41+/m0/s1 |
| InChIKey | XIMLRWBJDSXSBU-RFOFGYPUSA-N |
| XLogP | 8.09 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.95 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|