C31H42O5Si — CID 53392125
(4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one (PubChem CID 53392125) has the molecular formula C31H42O5Si and a molecular weight of 522.76 g/mol. Its IUPAC name is (4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one.
| Compound Name | (4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 53392125 |
| Molecular Formula | C31H42O5Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | (4'S,4aS,6S,8aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4',4a-dimethylspiro[3,4,6,7,8,8a-hexahydropyrano[3,2-b]pyran-2,5'-oxolane]-2'-one |
| SMILES | C[C@H]1CC(=O)OC12CC[C@]1(C)O[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@H]1O2 |
| InChI | InChI=1S/C31H42O5Si/c1-23-22-28(32)36-31(23)20-19-30(5)27(35-31)17-16-24(34-30)18-21-33-37(29(2,3)4,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-15,23-24,27H,16-22H2,1-5H3/t23-,24-,27+,30-,31?/m0/s1 |
| InChIKey | YAJGWUKADCORAA-YMSNOSOBSA-N |
| XLogP | 5.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|