C39H58O7Si — CID 134971620
methyl (5R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(Z)-3-(2-heptyl-1,3-dioxolan-2-yl)prop-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carboxylate (PubChem CID 134971620) has the molecular formula C39H58O7Si and a molecular weight of 666.97 g/mol. Its IUPAC name is methyl (5R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(Z)-3-(2-heptyl-1,3-dioxolan-2-yl)prop-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carboxylate.
| Compound Name | methyl (5R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(Z)-3-(2-heptyl-1,3-dioxolan-2-yl)prop-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carboxylate |
|---|---|
| PubChem CID | 134971620 |
| Molecular Formula | C39H58O7Si |
| Molecular Weight | 666.97 g/mol |
| Exact Mass | 666.40 |
| IUPAC Name | methyl (5R)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(Z)-3-(2-heptyl-1,3-dioxolan-2-yl)prop-1-enyl]-2,2-dimethyl-1,3-dioxane-4-carboxylate |
| SMILES | CCCCCCCC1(C/C=C\[C@@H]2COC(C)(C)OC2(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)OC)OCCO1 |
| InChI | InChI=1S/C39H58O7Si/c1-8-9-10-11-18-25-38(42-29-30-43-38)26-19-20-32-31-44-37(5,6)46-39(32,35(40)41-7)27-28-45-47(36(2,3)4,33-21-14-12-15-22-33)34-23-16-13-17-24-34/h12-17,19-24,32H,8-11,18,25-31H2,1-7H3/b20-19-/t32-,39?/m1/s1 |
| InChIKey | QVEIIJMKVBOELS-JPPCVELVSA-N |
| XLogP | 7.31 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.97 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|