C37H54O6Si — CID 58370584
3-[(2S,3aR,5R,7aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-3-oxobutyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 58370584) has the molecular formula C37H54O6Si and a molecular weight of 622.92 g/mol. Its IUPAC name is 3-[(2S,3aR,5R,7aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-3-oxobutyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,3aR,5R,7aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-3-oxobutyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58370584 |
| Molecular Formula | C37H54O6Si |
| Molecular Weight | 622.92 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | 3-[(2S,3aR,5R,7aS)-3a-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(2R)-2-methyl-3-oxobutyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)[C@H](C)C[C@H]1CC[C@@H]2O[C@@H](CCCOC(=O)C(C)(C)C)C[C@]2(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C37H54O6Si/c1-27(28(2)38)24-29-21-22-33-37(43-29,25-30(42-33)16-15-23-40-34(39)35(3,4)5)26-41-44(36(6,7)8,31-17-11-9-12-18-31)32-19-13-10-14-20-32/h9-14,17-20,27,29-30,33H,15-16,21-26H2,1-8H3/t27-,29-,30+,33+,37-/m1/s1 |
| InChIKey | ALVPGLFCZLQHRA-NKUCMWISSA-N |
| XLogP | 6.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.92 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|