C37H54O6Si — CID 11354082
2-[(4aS,5S,7S,8aR)-7-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 11354082) has the molecular formula C37H54O6Si and a molecular weight of 622.92 g/mol. Its IUPAC name is 2-[(4aS,5S,7S,8aR)-7-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(4aS,5S,7S,8aR)-7-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11354082 |
| Molecular Formula | C37H54O6Si |
| Molecular Weight | 622.92 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | 2-[(4aS,5S,7S,8aR)-7-[(E)-4-[tert-butyl(diphenyl)silyl]oxybut-1-enyl]-2,2,4a-trimethyl-5,7,8,8a-tetrahydro-4H-pyrano[4,3-d][1,3]dioxin-5-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)OC[C@@]2(C)[C@H](CCOC(=O)C(C)(C)C)O[C@H](/C=C/CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]2O1 |
| InChI | InChI=1S/C37H54O6Si/c1-34(2,3)33(38)39-25-23-31-37(9)27-40-36(7,8)43-32(37)26-28(42-31)18-16-17-24-41-44(35(4,5)6,29-19-12-10-13-20-29)30-21-14-11-15-22-30/h10-16,18-22,28,31-32H,17,23-27H2,1-9H3/b18-16+/t28-,31+,32-,37+/m1/s1 |
| InChIKey | BDHKRNZDZPAPKX-VGCDAZEBSA-N |
| XLogP | 6.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.92 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|