C26H47NO5Si — CID 123955181
3-[(3aR,5R,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 123955181) has the molecular formula C26H47NO5Si and a molecular weight of 481.75 g/mol. Its IUPAC name is 3-[(3aR,5R,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(3aR,5R,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123955181 |
| Molecular Formula | C26H47NO5Si |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | 3-[(3aR,5R,7aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | [C-]#[N+][C@H](C)C[C@H]1CC[C@@H]2OC(CCCOC(=O)C(C)(C)C)C[C@]2(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H47NO5Si/c1-19(27-8)16-20-13-14-22-26(32-20,18-30-33(9,10)25(5,6)7)17-21(31-22)12-11-15-29-23(28)24(2,3)4/h19-22H,11-18H2,1-7,9-10H3/t19-,20-,21?,22+,26-/m1/s1 |
| InChIKey | RQJQFDHHKQPYKS-FQPQAIARSA-N |
| XLogP | 6.15 |
| TPSA | 58.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|