C29H40O6Si — CID 12039246
ethyl 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetate (PubChem CID 12039246) has the molecular formula C29H40O6Si and a molecular weight of 512.72 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 12039246 |
| Molecular Formula | C29H40O6Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | ethyl 2-[(2S,3R,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]oxolan-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H]([C@H]2COC(C)(C)O2)OC[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H40O6Si/c1-7-31-26(30)18-23-24(19-32-27(23)25-20-33-29(5,6)34-25)35-36(28(2,3)4,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,23-25,27H,7,18-20H2,1-6H3/t23-,24-,25+,27-/m0/s1 |
| InChIKey | WPUIGVYAIWAOLQ-CLPFNFTISA-N |
| XLogP | 4.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|