C35H54O7Si — CID 154707778
4-[(4S,6S)-6-[(1R,2R,4S,5S)-8-[tert-butyl(diphenyl)silyl]oxy-1,4,5-trihydroxy-2-methyloctyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-one (PubChem CID 154707778) has the molecular formula C35H54O7Si and a molecular weight of 614.90 g/mol. Its IUPAC name is 4-[(4S,6S)-6-[(1R,2R,4S,5S)-8-[tert-butyl(diphenyl)silyl]oxy-1,4,5-trihydroxy-2-methyloctyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-one.
| Compound Name | 4-[(4S,6S)-6-[(1R,2R,4S,5S)-8-[tert-butyl(diphenyl)silyl]oxy-1,4,5-trihydroxy-2-methyloctyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 154707778 |
| Molecular Formula | C35H54O7Si |
| Molecular Weight | 614.90 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | 4-[(4S,6S)-6-[(1R,2R,4S,5S)-8-[tert-butyl(diphenyl)silyl]oxy-1,4,5-trihydroxy-2-methyloctyl]-2,2-dimethyl-1,3-dioxan-4-yl]butan-2-one |
| SMILES | CC(=O)CC[C@H]1C[C@@H]([C@H](O)[C@H](C)C[C@H](O)[C@@H](O)CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C35H54O7Si/c1-25(33(39)32-24-27(21-20-26(2)36)41-35(6,7)42-32)23-31(38)30(37)19-14-22-40-43(34(3,4)5,28-15-10-8-11-16-28)29-17-12-9-13-18-29/h8-13,15-18,25,27,30-33,37-39H,14,19-24H2,1-7H3/t25-,27+,30+,31+,32+,33-/m1/s1 |
| InChIKey | ZVNQFPFQOSPRQI-CQNASFLRSA-N |
| XLogP | 4.73 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|