C33H52O6Si2 — CID 11028391
(2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-4-methylpentan-1-one (PubChem CID 11028391) has the molecular formula C33H52O6Si2 and a molecular weight of 600.95 g/mol. Its IUPAC name is (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-4-methylpentan-1-one.
| Compound Name | (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-4-methylpentan-1-one |
|---|---|
| PubChem CID | 11028391 |
| Molecular Formula | C33H52O6Si2 |
| Molecular Weight | 600.95 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | (2R,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-4-methylpentan-1-one |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C33H52O6Si2/c1-24(22-37-41(32(5,6)7,25-18-14-12-15-19-25)26-20-16-13-17-21-26)28(34)30(39-40(10,11)31(2,3)4)29(35)27-23-36-33(8,9)38-27/h12-21,24,27-28,30,34H,22-23H2,1-11H3/t24-,27-,28-,30+/m0/s1 |
| InChIKey | ZAGSCOQBGBOARZ-CGQUYWBPSA-N |
| XLogP | 5.67 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|