C37H53BrO6S2Si — CID 10963775
[(2R)-5-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-oxo-1-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-yl] 2-bromoacetate (PubChem CID 10963775) has the molecular formula C37H53BrO6S2Si and a molecular weight of 765.95 g/mol. Its IUPAC name is [(2R)-5-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-oxo-1-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-yl] 2-bromoacetate.
| Compound Name | [(2R)-5-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-oxo-1-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-yl] 2-bromoacetate |
|---|---|
| PubChem CID | 10963775 |
| Molecular Formula | C37H53BrO6S2Si |
| Molecular Weight | 765.95 g/mol |
| Exact Mass | 764.22 |
| IUPAC Name | [(2R)-5-[2-[1-[tert-butyl(diphenyl)silyl]oxy-2-methylpropan-2-yl]-1,3-dithian-2-yl]-4-oxo-1-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]pentan-2-yl] 2-bromoacetate |
| SMILES | C[C@H]1OC(C)(C)O[C@@H]1C[C@H](CC(=O)CC1(C(C)(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)SCCCS1)OC(=O)CBr |
| InChI | InChI=1S/C37H53BrO6S2Si/c1-27-32(44-36(7,8)43-27)23-29(42-33(40)25-38)22-28(39)24-37(45-20-15-21-46-37)35(5,6)26-41-47(34(2,3)4,30-16-11-9-12-17-30)31-18-13-10-14-19-31/h9-14,16-19,27,29,32H,15,20-26H2,1-8H3/t27-,29+,32-/m1/s1 |
| InChIKey | VVBGYRLHZATRCB-LFWISAHLSA-N |
| XLogP | 7.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.95 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|