C29H52O3SSi2 — CID 10792474
(E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one (PubChem CID 10792474) has the molecular formula C29H52O3SSi2 and a molecular weight of 536.97 g/mol. Its IUPAC name is (E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one.
| Compound Name | (E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one |
|---|---|
| PubChem CID | 10792474 |
| Molecular Formula | C29H52O3SSi2 |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | (E)-7-[tert-butyl(dimethyl)silyl]oxy-5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-1-phenylsulfanylhept-5-en-3-one |
| SMILES | CC(C)(CSc1ccccc1)C(=O)C/C(=C/CO[Si](C)(C)C(C)(C)C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H52O3SSi2/c1-27(2,3)34(9,10)31-20-18-24(19-21-32-35(11,12)28(4,5)6)22-26(30)29(7,8)23-33-25-16-14-13-15-17-25/h13-18H,19-23H2,1-12H3/b24-18+ |
| InChIKey | HDGNUEUHRCPCRN-HKOYGPOVSA-N |
| XLogP | 9.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|