C20H32O2SSi — CID 102141049
1-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanyloct-7-en-4-one (PubChem CID 102141049) has the molecular formula C20H32O2SSi and a molecular weight of 364.63 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanyloct-7-en-4-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanyloct-7-en-4-one |
|---|---|
| PubChem CID | 102141049 |
| Molecular Formula | C20H32O2SSi |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanyloct-7-en-4-one |
| SMILES | C=CCC(Sc1ccccc1)C(=O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O2SSi/c1-7-12-19(23-17-13-9-8-10-14-17)18(21)15-11-16-22-24(5,6)20(2,3)4/h7-10,13-14,19H,1,11-12,15-16H2,2-6H3 |
| InChIKey | ANHWZIQTMOSCNB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|