C19H32O3SSi — CID 19096687
6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhexan-2-one (PubChem CID 19096687) has the molecular formula C19H32O3SSi and a molecular weight of 368.62 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhexan-2-one.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhexan-2-one |
|---|---|
| PubChem CID | 19096687 |
| Molecular Formula | C19H32O3SSi |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhexan-2-one |
| SMILES | Cc1ccc(S(=O)CC(=O)CCCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32O3SSi/c1-16-10-12-18(13-11-16)23(21)15-17(20)9-7-8-14-22-24(5,6)19(2,3)4/h10-13H,7-9,14-15H2,1-6H3 |
| InChIKey | ORIDIETVJDHNML-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|