C17H22O2S — CID 14786699
2-methyl-6-[(S)-(4-methylphenyl)sulfinyl]nona-1,8-dien-5-one (PubChem CID 14786699) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-methyl-6-[(S)-(4-methylphenyl)sulfinyl]nona-1,8-dien-5-one.
| Compound Name | 2-methyl-6-[(S)-(4-methylphenyl)sulfinyl]nona-1,8-dien-5-one |
|---|---|
| PubChem CID | 14786699 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-methyl-6-[(S)-(4-methylphenyl)sulfinyl]nona-1,8-dien-5-one |
| SMILES | C=CCC(C(=O)CCC(=C)C)[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O2S/c1-5-6-17(16(18)12-7-13(2)3)20(19)15-10-8-14(4)9-11-15/h5,8-11,17H,1-2,6-7,12H2,3-4H3/t17?,20-/m1/s1 |
| InChIKey | FNROUMIHZAMSIJ-UUSAFJCLSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|