C17H28O2SSi — CID 134933400
trimethyl-[(2Z)-2-[[(R)-(4-methylphenyl)sulfinyl]methylidene]hexoxy]silane (PubChem CID 134933400) has the molecular formula C17H28O2SSi and a molecular weight of 324.56 g/mol. Its IUPAC name is trimethyl-[(2Z)-2-[[(R)-(4-methylphenyl)sulfinyl]methylidene]hexoxy]silane.
| Compound Name | trimethyl-[(2Z)-2-[[(R)-(4-methylphenyl)sulfinyl]methylidene]hexoxy]silane |
|---|---|
| PubChem CID | 134933400 |
| Molecular Formula | C17H28O2SSi |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | trimethyl-[(2Z)-2-[[(R)-(4-methylphenyl)sulfinyl]methylidene]hexoxy]silane |
| SMILES | CCCC/C(=C/[S@@](=O)c1ccc(C)cc1)CO[Si](C)(C)C |
| InChI | InChI=1S/C17H28O2SSi/c1-6-7-8-16(13-19-21(3,4)5)14-20(18)17-11-9-15(2)10-12-17/h9-12,14H,6-8,13H2,1-5H3/b16-14-/t20-/m1/s1 |
| InChIKey | CJAJNHGQYVUDOF-FZWACIFYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|