C37H52O6SSi — CID 10963333
(3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1-[(R)-(4-methylphenyl)sulfinyl]decan-2-one (PubChem CID 10963333) has the molecular formula C37H52O6SSi and a molecular weight of 652.97 g/mol. Its IUPAC name is (3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1-[(R)-(4-methylphenyl)sulfinyl]decan-2-one.
| Compound Name | (3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1-[(R)-(4-methylphenyl)sulfinyl]decan-2-one |
|---|---|
| PubChem CID | 10963333 |
| Molecular Formula | C37H52O6SSi |
| Molecular Weight | 652.97 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | (3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1-[(R)-(4-methylphenyl)sulfinyl]decan-2-one |
| SMILES | COCCOCO[C@@H](CCCCC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)C[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H52O6SSi/c1-30-22-24-32(25-23-30)44(39)28-35(38)36(42-29-41-27-26-40-6)21-15-7-10-16-31(2)43-45(37(3,4)5,33-17-11-8-12-18-33)34-19-13-9-14-20-34/h8-9,11-14,17-20,22-25,31,36H,7,10,15-16,21,26-29H2,1-6H3/t31-,36+,44-/m1/s1 |
| InChIKey | LIGLLBYYMJLENG-XMSGFMMBSA-N |
| XLogP | 6.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|