C30H38O3SSi — CID 10413883
7-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-one (PubChem CID 10413883) has the molecular formula C30H38O3SSi and a molecular weight of 506.78 g/mol. Its IUPAC name is 7-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-one.
| Compound Name | 7-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-one |
|---|---|
| PubChem CID | 10413883 |
| Molecular Formula | C30H38O3SSi |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 7-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]heptan-2-one |
| SMILES | Cc1ccc([S@](=O)CC(=O)CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H38O3SSi/c1-25-19-21-27(22-20-25)34(32)24-26(31)14-8-7-13-23-33-35(30(2,3)4,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h5-6,9-12,15-22H,7-8,13-14,23-24H2,1-4H3/t34-/m1/s1 |
| InChIKey | YLNSFUQSONTMOW-UUWRZZSWSA-N |
| XLogP | 5.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|