C27H42O3S2Si — CID 139253747
[(2S)-2-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]hexoxy]-tert-butyl-dimethylsilane (PubChem CID 139253747) has the molecular formula C27H42O3S2Si and a molecular weight of 506.85 g/mol. Its IUPAC name is [(2S)-2-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]hexoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2S)-2-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]hexoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 139253747 |
| Molecular Formula | C27H42O3S2Si |
| Molecular Weight | 506.85 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [(2S)-2-[bis[(S)-(4-methylphenyl)sulfinyl]methyl]hexoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCC[C@@H](CO[Si](C)(C)C(C)(C)C)C([S@@](=O)c1ccc(C)cc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H42O3S2Si/c1-9-10-11-23(20-30-33(7,8)27(4,5)6)26(31(28)24-16-12-21(2)13-17-24)32(29)25-18-14-22(3)15-19-25/h12-19,23,26H,9-11,20H2,1-8H3/t23-,31-,32-/m0/s1 |
| InChIKey | SDKVEXWPVFJGCX-OUWPPHQMSA-N |
| XLogP | 7.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.85 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|