C23H34O2SSi — CID 72962573
[2-(4-methylphenyl)sulfinylphenyl]methoxy-tri(propan-2-yl)silane (PubChem CID 72962573) has the molecular formula C23H34O2SSi and a molecular weight of 402.68 g/mol. Its IUPAC name is [2-(4-methylphenyl)sulfinylphenyl]methoxy-tri(propan-2-yl)silane.
| Compound Name | [2-(4-methylphenyl)sulfinylphenyl]methoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 72962573 |
| Molecular Formula | C23H34O2SSi |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [2-(4-methylphenyl)sulfinylphenyl]methoxy-tri(propan-2-yl)silane |
| SMILES | Cc1ccc(S(=O)c2ccccc2CO[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H34O2SSi/c1-17(2)27(18(3)4,19(5)6)25-16-21-10-8-9-11-23(21)26(24)22-14-12-20(7)13-15-22/h8-15,17-19H,16H2,1-7H3 |
| InChIKey | SKVZXBLCJMQULQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|