C31H40O2SSi — CID 90781945
tert-butyl-[4-(2-cyclopentylsulfinylphenyl)butoxy]-diphenylsilane (PubChem CID 90781945) has the molecular formula C31H40O2SSi and a molecular weight of 504.81 g/mol. Its IUPAC name is tert-butyl-[4-(2-cyclopentylsulfinylphenyl)butoxy]-diphenylsilane.
| Compound Name | tert-butyl-[4-(2-cyclopentylsulfinylphenyl)butoxy]-diphenylsilane |
|---|---|
| PubChem CID | 90781945 |
| Molecular Formula | C31H40O2SSi |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | tert-butyl-[4-(2-cyclopentylsulfinylphenyl)butoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCc1ccccc1S(=O)C1CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H40O2SSi/c1-31(2,3)35(28-20-6-4-7-21-28,29-22-8-5-9-23-29)33-25-15-14-17-26-16-10-13-24-30(26)34(32)27-18-11-12-19-27/h4-10,13,16,20-24,27H,11-12,14-15,17-19,25H2,1-3H3 |
| InChIKey | UZLULBKYFZOHPK-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|