C46H56O4SSi2 — CID 10462841
6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-one (PubChem CID 10462841) has the molecular formula C46H56O4SSi2 and a molecular weight of 761.19 g/mol. Its IUPAC name is 6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-one.
| Compound Name | 6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-one |
|---|---|
| PubChem CID | 10462841 |
| Molecular Formula | C46H56O4SSi2 |
| Molecular Weight | 761.19 g/mol |
| Exact Mass | 760.34 |
| IUPAC Name | 6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-one |
| SMILES | Cc1ccc([S@](=O)CC(=O)CCC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C46H56O4SSi2/c1-37-28-32-40(33-29-37)51(48)36-39(47)31-30-38(34-49-52(45(2,3)4,41-20-12-8-13-21-41)42-22-14-9-15-23-42)35-50-53(46(5,6)7,43-24-16-10-17-25-43)44-26-18-11-19-27-44/h8-29,32-33,38H,30-31,34-36H2,1-7H3/t51-/m1/s1 |
| InChIKey | YFLAXWRWAVTMJB-NLXJDERGSA-N |
| XLogP | 8.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.19 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|