C28H34O3SSi — CID 71492716
5-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one (PubChem CID 71492716) has the molecular formula C28H34O3SSi and a molecular weight of 478.73 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one |
|---|---|
| PubChem CID | 71492716 |
| Molecular Formula | C28H34O3SSi |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]pentan-2-one |
| SMILES | Cc1ccc([S@](=O)CC(=O)CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H34O3SSi/c1-23-17-19-25(20-18-23)32(30)22-24(29)12-11-21-31-33(28(2,3)4,26-13-7-5-8-14-26)27-15-9-6-10-16-27/h5-10,13-20H,11-12,21-22H2,1-4H3/t32-/m1/s1 |
| InChIKey | QNOGFVRJGBTNGD-JGCGQSQUSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|