C34H38O2S2Si — CID 14188350
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one (PubChem CID 14188350) has the molecular formula C34H38O2S2Si and a molecular weight of 570.90 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one |
|---|---|
| PubChem CID | 14188350 |
| Molecular Formula | C34H38O2S2Si |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one |
| SMILES | Cc1ccc(SC(Sc2ccc(C)cc2)C(=O)[C@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H38O2S2Si/c1-25-17-21-28(22-18-25)37-33(38-29-23-19-26(2)20-24-29)32(35)27(3)36-39(34(4,5)6,30-13-9-7-10-14-30)31-15-11-8-12-16-31/h7-24,27,33H,1-6H3/t27-/m0/s1 |
| InChIKey | ZEESMNPPLGQJPH-MHZLTWQESA-N |
| XLogP | 8.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|