C34H38O3S2Si — CID 11124779
tert-butyl-[(E)-4-deuterio-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-diphenylsilane (PubChem CID 11124779) has the molecular formula C34H38O3S2Si and a molecular weight of 587.90 g/mol. Its IUPAC name is tert-butyl-[(E)-4-deuterio-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(E)-4-deuterio-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11124779 |
| Molecular Formula | C34H38O3S2Si |
| Molecular Weight | 587.90 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | tert-butyl-[(E)-4-deuterio-3,4-bis[(4-methylphenyl)sulfinyl]but-3-enoxy]-diphenylsilane |
| SMILES | [2H]/C(=C(/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)S(=O)c1ccc(C)cc1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H38O3S2Si/c1-27-16-20-29(21-17-27)38(35)26-31(39(36)30-22-18-28(2)19-23-30)24-25-37-40(34(3,4)5,32-12-8-6-9-13-32)33-14-10-7-11-15-33/h6-23,26H,24-25H2,1-5H3/b31-26+/i26D |
| InChIKey | BKBFOUYLWRAUJC-ZUZNWTQRSA-N |
| XLogP | 7.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.90 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|