C45H54O3SSi2 — CID 101461759
tert-butyl-[(Z,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-(4-methylphenyl)sulfinylpent-2-enoxy]-diphenylsilane (PubChem CID 101461759) has the molecular formula C45H54O3SSi2 and a molecular weight of 731.16 g/mol. Its IUPAC name is tert-butyl-[(Z,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-(4-methylphenyl)sulfinylpent-2-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(Z,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-(4-methylphenyl)sulfinylpent-2-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101461759 |
| Molecular Formula | C45H54O3SSi2 |
| Molecular Weight | 731.16 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | tert-butyl-[(Z,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyl-5-(4-methylphenyl)sulfinylpent-2-enoxy]-diphenylsilane |
| SMILES | C/C(=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](CS(=O)c1ccc(C)cc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C45H54O3SSi2/c1-36-29-31-38(32-30-36)49(46)35-43(48-51(45(6,7)8,41-25-17-11-18-26-41)42-27-19-12-20-28-42)37(2)33-34-47-50(44(3,4)5,39-21-13-9-14-22-39)40-23-15-10-16-24-40/h9-33,43H,34-35H2,1-8H3/b37-33-/t43-,49?/m1/s1 |
| InChIKey | UNMKUGNNABJUHG-PWCHEKHHSA-N |
| XLogP | 8.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.16 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|