C33H30OSSeSi — CID 11813910
[2-[(S)-(4-methylphenyl)sulfinyl]-2-phenylselanylethyl]-triphenylsilane (PubChem CID 11813910) has the molecular formula C33H30OSSeSi and a molecular weight of 581.72 g/mol. Its IUPAC name is [2-[(S)-(4-methylphenyl)sulfinyl]-2-phenylselanylethyl]-triphenylsilane.
| Compound Name | [2-[(S)-(4-methylphenyl)sulfinyl]-2-phenylselanylethyl]-triphenylsilane |
|---|---|
| PubChem CID | 11813910 |
| Molecular Formula | C33H30OSSeSi |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | [2-[(S)-(4-methylphenyl)sulfinyl]-2-phenylselanylethyl]-triphenylsilane |
| SMILES | Cc1ccc([S@](=O)C(C[Si](c2ccccc2)(c2ccccc2)c2ccccc2)[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30OSSeSi/c1-27-22-24-28(25-23-27)35(34)33(36-29-14-6-2-7-15-29)26-37(30-16-8-3-9-17-30,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-25,33H,26H2,1H3/t33?,35-/m0/s1 |
| InChIKey | YAVJDQKWEKKMSQ-XZEQTHJSSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|