C18H28O4S — CID 13164092
4-(benzenesulfonyl)-1-hydroxy-2-methylundecan-3-one (PubChem CID 13164092) has the molecular formula C18H28O4S and a molecular weight of 340.49 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-hydroxy-2-methylundecan-3-one.
| Compound Name | 4-(benzenesulfonyl)-1-hydroxy-2-methylundecan-3-one |
|---|---|
| PubChem CID | 13164092 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-(benzenesulfonyl)-1-hydroxy-2-methylundecan-3-one |
| SMILES | CCCCCCCC(C(=O)C(C)CO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28O4S/c1-3-4-5-6-10-13-17(18(20)15(2)14-19)23(21,22)16-11-8-7-9-12-16/h7-9,11-12,15,17,19H,3-6,10,13-14H2,1-2H3 |
| InChIKey | OTDCYFJHMYIWMN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|