C22H26O2S2 — CID 23649649
S-phenyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanethioate (PubChem CID 23649649) has the molecular formula C22H26O2S2 and a molecular weight of 386.58 g/mol. Its IUPAC name is S-phenyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanethioate.
| Compound Name | S-phenyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanethioate |
|---|---|
| PubChem CID | 23649649 |
| Molecular Formula | C22H26O2S2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | S-phenyl (2S,3R)-3-cyclohexyl-3-hydroxy-2-(phenylsulfanylmethyl)propanethioate |
| SMILES | O=C(Sc1ccccc1)[C@H](CSc1ccccc1)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C22H26O2S2/c23-21(17-10-4-1-5-11-17)20(16-25-18-12-6-2-7-13-18)22(24)26-19-14-8-3-9-15-19/h2-3,6-9,12-15,17,20-21,23H,1,4-5,10-11,16H2/t20-,21-/m1/s1 |
| InChIKey | CQYQELYJHSMCEI-NHCUHLMSSA-N |
| XLogP | 5.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|